C27H33N2O2S+ — CID 2062540
N-[3-[(S)-(4-ethoxyphenyl)-piperidin-1-ium-1-ylmethyl]-5-ethylthiophen-2-yl]benzamide (PubChem CID 2062540) has the molecular formula C27H33N2O2S+ and a molecular weight of 449.64 g/mol. Its IUPAC name is N-[3-[(S)-(4-ethoxyphenyl)-piperidin-1-ium-1-ylmethyl]-5-ethylthiophen-2-yl]benzamide.
| Compound Name | N-[3-[(S)-(4-ethoxyphenyl)-piperidin-1-ium-1-ylmethyl]-5-ethylthiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 2062540 |
| Molecular Formula | C27H33N2O2S+ |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-[3-[(S)-(4-ethoxyphenyl)-piperidin-1-ium-1-ylmethyl]-5-ethylthiophen-2-yl]benzamide |
| SMILES | CCOc1ccc([C@@H](c2cc(CC)sc2NC(=O)c2ccccc2)[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C27H32N2O2S/c1-3-23-19-24(27(32-23)28-26(30)21-11-7-5-8-12-21)25(29-17-9-6-10-18-29)20-13-15-22(16-14-20)31-4-2/h5,7-8,11-16,19,25H,3-4,6,9-10,17-18H2,1-2H3,(H,28,30)/p+1/t25-/m0/s1 |
| InChIKey | AJIBXAQCZZSLDK-VWLOTQADSA-O |
| XLogP | 5.12 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |