C25H28ClN2OS+ — CID 2062600
N-[3-[(R)-(3-chlorophenyl)-piperidin-1-ium-1-ylmethyl]-5-ethylthiophen-2-yl]benzamide (PubChem CID 2062600) has the molecular formula C25H28ClN2OS+ and a molecular weight of 440.03 g/mol. Its IUPAC name is N-[3-[(R)-(3-chlorophenyl)-piperidin-1-ium-1-ylmethyl]-5-ethylthiophen-2-yl]benzamide.
| Compound Name | N-[3-[(R)-(3-chlorophenyl)-piperidin-1-ium-1-ylmethyl]-5-ethylthiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 2062600 |
| Molecular Formula | C25H28ClN2OS+ |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[3-[(R)-(3-chlorophenyl)-piperidin-1-ium-1-ylmethyl]-5-ethylthiophen-2-yl]benzamide |
| SMILES | CCc1cc([C@@H](c2cccc(Cl)c2)[NH+]2CCCCC2)c(NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C25H27ClN2OS/c1-2-21-17-22(25(30-21)27-24(29)18-10-5-3-6-11-18)23(28-14-7-4-8-15-28)19-12-9-13-20(26)16-19/h3,5-6,9-13,16-17,23H,2,4,7-8,14-15H2,1H3,(H,27,29)/p+1/t23-/m1/s1 |
| InChIKey | XZZYBFZNQQYUGG-HSZRJFAPSA-O |
| XLogP | 5.37 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |