C27H32N2O2S — CID 1416890
N-[5-ethyl-3-[(S)-morpholin-4-yl-(4-propan-2-ylphenyl)methyl]thiophen-2-yl]benzamide (PubChem CID 1416890) has the molecular formula C27H32N2O2S and a molecular weight of 448.63 g/mol. Its IUPAC name is N-[5-ethyl-3-[(S)-morpholin-4-yl-(4-propan-2-ylphenyl)methyl]thiophen-2-yl]benzamide.
| Compound Name | N-[5-ethyl-3-[(S)-morpholin-4-yl-(4-propan-2-ylphenyl)methyl]thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 1416890 |
| Molecular Formula | C27H32N2O2S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | N-[5-ethyl-3-[(S)-morpholin-4-yl-(4-propan-2-ylphenyl)methyl]thiophen-2-yl]benzamide |
| SMILES | CCc1cc([C@H](c2ccc(C(C)C)cc2)N2CCOCC2)c(NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C27H32N2O2S/c1-4-23-18-24(27(32-23)28-26(30)22-8-6-5-7-9-22)25(29-14-16-31-17-15-29)21-12-10-20(11-13-21)19(2)3/h5-13,18-19,25H,4,14-17H2,1-3H3,(H,28,30)/t25-/m0/s1 |
| InChIKey | NBFMOKSIUCKOKI-VWLOTQADSA-N |
| XLogP | 6.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |