C22H23BrN2O3S — CID 93479027
N-[3-[(R)-(4-bromophenyl)-morpholin-4-ylmethyl]-5-ethylthiophen-2-yl]furan-2-carboxamide (PubChem CID 93479027) has the molecular formula C22H23BrN2O3S and a molecular weight of 475.41 g/mol. Its IUPAC name is N-[3-[(R)-(4-bromophenyl)-morpholin-4-ylmethyl]-5-ethylthiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[3-[(R)-(4-bromophenyl)-morpholin-4-ylmethyl]-5-ethylthiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 93479027 |
| Molecular Formula | C22H23BrN2O3S |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | N-[3-[(R)-(4-bromophenyl)-morpholin-4-ylmethyl]-5-ethylthiophen-2-yl]furan-2-carboxamide |
| SMILES | CCc1cc([C@@H](c2ccc(Br)cc2)N2CCOCC2)c(NC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C22H23BrN2O3S/c1-2-17-14-18(22(29-17)24-21(26)19-4-3-11-28-19)20(25-9-12-27-13-10-25)15-5-7-16(23)8-6-15/h3-8,11,14,20H,2,9-10,12-13H2,1H3,(H,24,26)/t20-/m1/s1 |
| InChIKey | CGLKIZZUALUNNY-HXUWFJFHSA-N |
| XLogP | 5.34 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |