C20H22N2O3S2 — CID 93479142
N-[5-ethyl-3-[(S)-morpholin-4-yl(thiophen-3-yl)methyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 93479142) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[5-ethyl-3-[(S)-morpholin-4-yl(thiophen-3-yl)methyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-ethyl-3-[(S)-morpholin-4-yl(thiophen-3-yl)methyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 93479142 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[5-ethyl-3-[(S)-morpholin-4-yl(thiophen-3-yl)methyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | CCc1cc([C@H](c2ccsc2)N2CCOCC2)c(NC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-2-15-12-16(20(27-15)21-19(23)17-4-3-8-25-17)18(14-5-11-26-13-14)22-6-9-24-10-7-22/h3-5,8,11-13,18H,2,6-7,9-10H2,1H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | ASJBPJZHJSFABQ-SFHVURJKSA-N |
| XLogP | 4.64 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |