C23H25BrN2O2S — CID 93478910
N-[3-[(S)-(3-bromophenyl)-piperidin-1-ylmethyl]-5-ethylthiophen-2-yl]furan-2-carboxamide (PubChem CID 93478910) has the molecular formula C23H25BrN2O2S and a molecular weight of 473.44 g/mol. Its IUPAC name is N-[3-[(S)-(3-bromophenyl)-piperidin-1-ylmethyl]-5-ethylthiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[3-[(S)-(3-bromophenyl)-piperidin-1-ylmethyl]-5-ethylthiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 93478910 |
| Molecular Formula | C23H25BrN2O2S |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | N-[3-[(S)-(3-bromophenyl)-piperidin-1-ylmethyl]-5-ethylthiophen-2-yl]furan-2-carboxamide |
| SMILES | CCc1cc([C@H](c2cccc(Br)c2)N2CCCCC2)c(NC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C23H25BrN2O2S/c1-2-18-15-19(23(29-18)25-22(27)20-10-7-13-28-20)21(26-11-4-3-5-12-26)16-8-6-9-17(24)14-16/h6-10,13-15,21H,2-5,11-12H2,1H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | VQQXWJGIAQGNRZ-NRFANRHFSA-N |
| XLogP | 6.49 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |