C26H30ClN3OS — CID 1416884
N-[3-[(S)-(4-chlorophenyl)-(4-ethylpiperazin-1-yl)methyl]-5-ethylthiophen-2-yl]benzamide (PubChem CID 1416884) has the molecular formula C26H30ClN3OS and a molecular weight of 468.07 g/mol. Its IUPAC name is N-[3-[(S)-(4-chlorophenyl)-(4-ethylpiperazin-1-yl)methyl]-5-ethylthiophen-2-yl]benzamide.
| Compound Name | N-[3-[(S)-(4-chlorophenyl)-(4-ethylpiperazin-1-yl)methyl]-5-ethylthiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 1416884 |
| Molecular Formula | C26H30ClN3OS |
| Molecular Weight | 468.07 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-[3-[(S)-(4-chlorophenyl)-(4-ethylpiperazin-1-yl)methyl]-5-ethylthiophen-2-yl]benzamide |
| SMILES | CCc1cc([C@H](c2ccc(Cl)cc2)N2CCN(CC)CC2)c(NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C26H30ClN3OS/c1-3-22-18-23(26(32-22)28-25(31)20-8-6-5-7-9-20)24(19-10-12-21(27)13-11-19)30-16-14-29(4-2)15-17-30/h5-13,18,24H,3-4,14-17H2,1-2H3,(H,28,31)/t24-/m0/s1 |
| InChIKey | VHIOAGCNDDRPBA-DEOSSOPVSA-N |
| XLogP | 5.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.07 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |