C20H22N3O+ — CID 5092864
7-[piperidin-1-ium-1-yl(pyridin-2-yl)methyl]quinolin-8-ol (PubChem CID 5092864) has the molecular formula C20H22N3O+ and a molecular weight of 320.42 g/mol. Its IUPAC name is 7-[piperidin-1-ium-1-yl(pyridin-2-yl)methyl]quinolin-8-ol.
| Compound Name | 7-[piperidin-1-ium-1-yl(pyridin-2-yl)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 5092864 |
| Molecular Formula | C20H22N3O+ |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 7-[piperidin-1-ium-1-yl(pyridin-2-yl)methyl]quinolin-8-ol |
| SMILES | Oc1c(C(c2ccccn2)[NH+]2CCCCC2)ccc2cccnc12 |
| InChI | InChI=1S/C20H21N3O/c24-20-16(10-9-15-7-6-12-22-18(15)20)19(17-8-2-3-11-21-17)23-13-4-1-5-14-23/h2-3,6-12,19,24H,1,4-5,13-14H2/p+1 |
| InChIKey | UNSBLTBZUIGZHT-UHFFFAOYSA-O |
| XLogP | 2.49 |
| TPSA | 50.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|