C22H22F3N2O+ — CID 6988629
7-[(R)-piperidin-1-ium-1-yl-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol (PubChem CID 6988629) has the molecular formula C22H22F3N2O+ and a molecular weight of 387.43 g/mol. Its IUPAC name is 7-[(R)-piperidin-1-ium-1-yl-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol.
| Compound Name | 7-[(R)-piperidin-1-ium-1-yl-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 6988629 |
| Molecular Formula | C22H22F3N2O+ |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 7-[(R)-piperidin-1-ium-1-yl-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol |
| SMILES | Oc1c([C@@H](c2ccc(C(F)(F)F)cc2)[NH+]2CCCCC2)ccc2cccnc12 |
| InChI | InChI=1S/C22H21F3N2O/c23-22(24,25)17-9-6-16(7-10-17)20(27-13-2-1-3-14-27)18-11-8-15-5-4-12-26-19(15)21(18)28/h4-12,20,28H,1-3,13-14H2/p+1/t20-/m1/s1 |
| InChIKey | LQWNWLCRLWPUPR-HXUWFJFHSA-O |
| XLogP | 4.12 |
| TPSA | 37.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|