C23H26F3N3O2+2 — CID 7565070
7-[(S)-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol (PubChem CID 7565070) has the molecular formula C23H26F3N3O2+2 and a molecular weight of 433.47 g/mol. Its IUPAC name is 7-[(S)-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol.
| Compound Name | 7-[(S)-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7565070 |
| Molecular Formula | C23H26F3N3O2+2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 7-[(S)-[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol |
| SMILES | OCC[NH+]1CC[NH+]([C@@H](c2ccc(C(F)(F)F)cc2)c2ccc3cccnc3c2O)CC1 |
| InChI | InChI=1S/C23H24F3N3O2/c24-23(25,26)18-6-3-17(4-7-18)21(29-12-10-28(11-13-29)14-15-30)19-8-5-16-2-1-9-27-20(16)22(19)31/h1-9,21,30-31H,10-15H2/p+2/t21-/m0/s1 |
| InChIKey | GFRXMINJBHBBBN-NRFANRHFSA-P |
| XLogP | 0.82 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|