C24H18ClF3N2O — CID 58542907
7-[2-(5-chloro-3-methyl-2-pyridinyl)-1-[4-(trifluoromethyl)phenyl]ethyl]quinolin-8-ol (PubChem CID 58542907) has the molecular formula C24H18ClF3N2O and a molecular weight of 442.87 g/mol. Its IUPAC name is 7-[2-(5-chloro-3-methyl-2-pyridinyl)-1-[4-(trifluoromethyl)phenyl]ethyl]quinolin-8-ol.
| Compound Name | 7-[2-(5-chloro-3-methyl-2-pyridinyl)-1-[4-(trifluoromethyl)phenyl]ethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 58542907 |
| Molecular Formula | C24H18ClF3N2O |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 7-[2-(5-chloro-3-methyl-2-pyridinyl)-1-[4-(trifluoromethyl)phenyl]ethyl]quinolin-8-ol |
| SMILES | Cc1cc(Cl)cnc1CC(c1ccc(C(F)(F)F)cc1)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C24H18ClF3N2O/c1-14-11-18(25)13-30-21(14)12-20(15-4-7-17(8-5-15)24(26,27)28)19-9-6-16-3-2-10-29-22(16)23(19)31/h2-11,13,20,31H,12H2,1H3 |
| InChIKey | BFWAMGIZRXPNDU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |