C24H16F6N2O — CID 58542713
7-[1-[4-(trifluoromethyl)phenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]quinolin-8-ol (PubChem CID 58542713) has the molecular formula C24H16F6N2O and a molecular weight of 462.39 g/mol. Its IUPAC name is 7-[1-[4-(trifluoromethyl)phenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]quinolin-8-ol.
| Compound Name | 7-[1-[4-(trifluoromethyl)phenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 58542713 |
| Molecular Formula | C24H16F6N2O |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 7-[1-[4-(trifluoromethyl)phenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]quinolin-8-ol |
| SMILES | Oc1c(C(Cc2ccc(C(F)(F)F)nc2)c2ccc(C(F)(F)F)cc2)ccc2cccnc12 |
| InChI | InChI=1S/C24H16F6N2O/c25-23(26,27)17-7-4-15(5-8-17)19(12-14-3-10-20(32-13-14)24(28,29)30)18-9-6-16-2-1-11-31-21(16)22(18)33/h1-11,13,19,33H,12H2 |
| InChIKey | VRPHSNSZYBWVBT-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |