C20H24N4O+2 — CID 6920079
7-[(S)-(4-methylpiperazine-1,4-diium-1-yl)-pyridin-4-ylmethyl]quinolin-8-ol (PubChem CID 6920079) has the molecular formula C20H24N4O+2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 7-[(S)-(4-methylpiperazine-1,4-diium-1-yl)-pyridin-4-ylmethyl]quinolin-8-ol.
| Compound Name | 7-[(S)-(4-methylpiperazine-1,4-diium-1-yl)-pyridin-4-ylmethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 6920079 |
| Molecular Formula | C20H24N4O+2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 7-[(S)-(4-methylpiperazine-1,4-diium-1-yl)-pyridin-4-ylmethyl]quinolin-8-ol |
| SMILES | C[NH+]1CC[NH+]([C@@H](c2ccncc2)c2ccc3cccnc3c2O)CC1 |
| InChI | InChI=1S/C20H22N4O/c1-23-11-13-24(14-12-23)19(16-6-9-21-10-7-16)17-5-4-15-3-2-8-22-18(15)20(17)25/h2-10,19,25H,11-14H2,1H3/p+2/t19-/m0/s1 |
| InChIKey | NQXCTRCPZLXMMO-IBGZPJMESA-P |
| XLogP | -0.16 |
| TPSA | 54.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|