C27H25ClN4O3 — CID 171148373
7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-pyridin-2-ylmethyl]-5-chloroquinolin-8-ol (PubChem CID 171148373) has the molecular formula C27H25ClN4O3 and a molecular weight of 488.98 g/mol. Its IUPAC name is 7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-pyridin-2-ylmethyl]-5-chloroquinolin-8-ol.
| Compound Name | 7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-pyridin-2-ylmethyl]-5-chloroquinolin-8-ol |
|---|---|
| PubChem CID | 171148373 |
| Molecular Formula | C27H25ClN4O3 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 7-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-pyridin-2-ylmethyl]-5-chloroquinolin-8-ol |
| SMILES | Oc1c(C(c2ccccn2)N2CCN(Cc3ccc4c(c3)OCO4)CC2)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C27H25ClN4O3/c28-21-15-20(27(33)25-19(21)4-3-9-30-25)26(22-5-1-2-8-29-22)32-12-10-31(11-13-32)16-18-6-7-23-24(14-18)35-17-34-23/h1-9,14-15,26,33H,10-13,16-17H2 |
| InChIKey | KHEYTFVKXZEGSF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|