C24H25ClN4O4 — CID 171434000
2-(3-aminopiperidin-1-yl)-N-[1,3-benzodioxol-5-yl-(5-chloro-8-hydroxyquinolin-7-yl)methyl]acetamide (PubChem CID 171434000) has the molecular formula C24H25ClN4O4 and a molecular weight of 468.94 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-N-[1,3-benzodioxol-5-yl-(5-chloro-8-hydroxyquinolin-7-yl)methyl]acetamide.
| Compound Name | 2-(3-aminopiperidin-1-yl)-N-[1,3-benzodioxol-5-yl-(5-chloro-8-hydroxyquinolin-7-yl)methyl]acetamide |
|---|---|
| PubChem CID | 171434000 |
| Molecular Formula | C24H25ClN4O4 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-N-[1,3-benzodioxol-5-yl-(5-chloro-8-hydroxyquinolin-7-yl)methyl]acetamide |
| SMILES | NC1CCCN(CC(=O)NC(c2ccc3c(c2)OCO3)c2cc(Cl)c3cccnc3c2O)C1 |
| InChI | InChI=1S/C24H25ClN4O4/c25-18-10-17(24(31)23-16(18)4-1-7-27-23)22(14-5-6-19-20(9-14)33-13-32-19)28-21(30)12-29-8-2-3-15(26)11-29/h1,4-7,9-10,15,22,31H,2-3,8,11-13,26H2,(H,28,30) |
| InChIKey | TWVGMYQXOZDEJT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|