C22H22N2O4 — CID 1084497
N-[(R)-1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]-3-methylbutanamide (PubChem CID 1084497) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[(R)-1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]-3-methylbutanamide.
| Compound Name | N-[(R)-1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 1084497 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[(R)-1,3-benzodioxol-5-yl-(8-hydroxyquinolin-7-yl)methyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)N[C@H](c1ccc2c(c1)OCO2)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C22H22N2O4/c1-13(2)10-19(25)24-20(15-6-8-17-18(11-15)28-12-27-17)16-7-5-14-4-3-9-23-21(14)22(16)26/h3-9,11,13,20,26H,10,12H2,1-2H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | BTBNYOUUABZLTP-HXUWFJFHSA-N |
| XLogP | 3.92 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|