C21H20F3N3O2 — CID 57383807
N-[(8-hydroxyquinolin-7-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]-3-methylbutanamide (PubChem CID 57383807) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is N-[(8-hydroxyquinolin-7-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]-3-methylbutanamide.
| Compound Name | N-[(8-hydroxyquinolin-7-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 57383807 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[(8-hydroxyquinolin-7-yl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(c1cnccc1C(F)(F)F)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C21H20F3N3O2/c1-12(2)10-17(28)27-19(15-11-25-9-7-16(15)21(22,23)24)14-6-5-13-4-3-8-26-18(13)20(14)29/h3-9,11-12,19,29H,10H2,1-2H3,(H,27,28) |
| InChIKey | YJANFWJSRZLLAV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|