C26H25F3N4O4 — CID 57383880
N-[(8-hydroxyquinolin-7-yl)-(4-imidazol-1-ylphenyl)methyl]-3-methylbutanamide;2,2,2-trifluoroacetic acid (PubChem CID 57383880) has the molecular formula C26H25F3N4O4 and a molecular weight of 514.50 g/mol. Its IUPAC name is N-[(8-hydroxyquinolin-7-yl)-(4-imidazol-1-ylphenyl)methyl]-3-methylbutanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(8-hydroxyquinolin-7-yl)-(4-imidazol-1-ylphenyl)methyl]-3-methylbutanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 57383880 |
| Molecular Formula | C26H25F3N4O4 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | N-[(8-hydroxyquinolin-7-yl)-(4-imidazol-1-ylphenyl)methyl]-3-methylbutanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CC(=O)NC(c1ccc(-n2ccnc2)cc1)c1ccc2cccnc2c1O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H24N4O2.C2HF3O2/c1-16(2)14-21(29)27-22(18-5-8-19(9-6-18)28-13-12-25-15-28)20-10-7-17-4-3-11-26-23(17)24(20)30;3-2(4,5)1(6)7/h3-13,15-16,22,30H,14H2,1-2H3,(H,27,29);(H,6,7) |
| InChIKey | HCXHHDDNBVZHJV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|