C24H20N2O3 — CID 1369908
N-[(S)-(8-hydroxyquinolin-7-yl)-(4-methoxyphenyl)methyl]benzamide (PubChem CID 1369908) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[(S)-(8-hydroxyquinolin-7-yl)-(4-methoxyphenyl)methyl]benzamide.
| Compound Name | N-[(S)-(8-hydroxyquinolin-7-yl)-(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 1369908 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[(S)-(8-hydroxyquinolin-7-yl)-(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc([C@H](NC(=O)c2ccccc2)c2ccc3cccnc3c2O)cc1 |
| InChI | InChI=1S/C24H20N2O3/c1-29-19-12-9-17(10-13-19)21(26-24(28)18-6-3-2-4-7-18)20-14-11-16-8-5-15-25-22(16)23(20)27/h2-15,21,27H,1H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | UNCSTXORGBARFG-NRFANRHFSA-N |
| XLogP | 4.47 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|