C24H18Cl2N2O3 — CID 2259163
N-[(R)-(5-chloro-8-hydroxyquinolin-7-yl)-(4-chlorophenyl)methyl]-4-methoxybenzamide (PubChem CID 2259163) has the molecular formula C24H18Cl2N2O3 and a molecular weight of 453.33 g/mol. Its IUPAC name is N-[(R)-(5-chloro-8-hydroxyquinolin-7-yl)-(4-chlorophenyl)methyl]-4-methoxybenzamide.
| Compound Name | N-[(R)-(5-chloro-8-hydroxyquinolin-7-yl)-(4-chlorophenyl)methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 2259163 |
| Molecular Formula | C24H18Cl2N2O3 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | N-[(R)-(5-chloro-8-hydroxyquinolin-7-yl)-(4-chlorophenyl)methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H](c2ccc(Cl)cc2)c2cc(Cl)c3cccnc3c2O)cc1 |
| InChI | InChI=1S/C24H18Cl2N2O3/c1-31-17-10-6-15(7-11-17)24(30)28-21(14-4-8-16(25)9-5-14)19-13-20(26)18-3-2-12-27-22(18)23(19)29/h2-13,21,29H,1H3,(H,28,30)/t21-/m1/s1 |
| InChIKey | BEKCSNIMRKXEFV-OAQYLSRUSA-N |
| XLogP | 5.78 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|