C22H23N3O6 — CID 171504697
tert-butyl N-[(8-hydroxy-5-nitroquinolin-7-yl)-(4-methoxyphenyl)methyl]carbamate (PubChem CID 171504697) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is tert-butyl N-[(8-hydroxy-5-nitroquinolin-7-yl)-(4-methoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(8-hydroxy-5-nitroquinolin-7-yl)-(4-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 171504697 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | tert-butyl N-[(8-hydroxy-5-nitroquinolin-7-yl)-(4-methoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(C(NC(=O)OC(C)(C)C)c2cc([N+](=O)[O-])c3cccnc3c2O)cc1 |
| InChI | InChI=1S/C22H23N3O6/c1-22(2,3)31-21(27)24-18(13-7-9-14(30-4)10-8-13)16-12-17(25(28)29)15-6-5-11-23-19(15)20(16)26/h5-12,18,26H,1-4H3,(H,24,27) |
| InChIKey | PYFYFCIAUFLPJP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|