C18H14ClN3O4 — CID 59201782
N-[(3-chlorophenyl)-(8-hydroxy-5-nitroquinolin-7-yl)methyl]acetamide (PubChem CID 59201782) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is N-[(3-chlorophenyl)-(8-hydroxy-5-nitroquinolin-7-yl)methyl]acetamide.
| Compound Name | N-[(3-chlorophenyl)-(8-hydroxy-5-nitroquinolin-7-yl)methyl]acetamide |
|---|---|
| PubChem CID | 59201782 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[(3-chlorophenyl)-(8-hydroxy-5-nitroquinolin-7-yl)methyl]acetamide |
| SMILES | CC(=O)NC(c1cccc(Cl)c1)c1cc([N+](=O)[O-])c2cccnc2c1O |
| InChI | InChI=1S/C18H14ClN3O4/c1-10(23)21-16(11-4-2-5-12(19)8-11)14-9-15(22(25)26)13-6-3-7-20-17(13)18(14)24/h2-9,16,24H,1H3,(H,21,23) |
| InChIKey | REUXAVVRYJADSV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|