C18H13ClN3O4- — CID 7318945
7-[(R)-acetamido-(2-chlorophenyl)methyl]-5-nitroquinolin-8-olate (PubChem CID 7318945) has the molecular formula C18H13ClN3O4- and a molecular weight of 370.77 g/mol. Its IUPAC name is 7-[(R)-acetamido-(2-chlorophenyl)methyl]-5-nitroquinolin-8-olate.
| Compound Name | 7-[(R)-acetamido-(2-chlorophenyl)methyl]-5-nitroquinolin-8-olate |
|---|---|
| PubChem CID | 7318945 |
| Molecular Formula | C18H13ClN3O4- |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 7-[(R)-acetamido-(2-chlorophenyl)methyl]-5-nitroquinolin-8-olate |
| SMILES | CC(=O)N[C@@H](c1ccccc1Cl)c1cc([N+](=O)[O-])c2cccnc2c1[O-] |
| InChI | InChI=1S/C18H14ClN3O4/c1-10(23)21-16(11-5-2-3-7-14(11)19)13-9-15(22(25)26)12-6-4-8-20-17(12)18(13)24/h2-9,16,24H,1H3,(H,21,23)/p-1/t16-/m0/s1 |
| InChIKey | BEJWOTFFISIHGQ-INIZCTEOSA-M |
| XLogP | 3.10 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|