C19H16ClN3O4 — CID 1084548
N-[(S)-(4-chlorophenyl)-(8-hydroxy-5-nitroquinolin-7-yl)methyl]propanamide (PubChem CID 1084548) has the molecular formula C19H16ClN3O4 and a molecular weight of 385.81 g/mol. Its IUPAC name is N-[(S)-(4-chlorophenyl)-(8-hydroxy-5-nitroquinolin-7-yl)methyl]propanamide.
| Compound Name | N-[(S)-(4-chlorophenyl)-(8-hydroxy-5-nitroquinolin-7-yl)methyl]propanamide |
|---|---|
| PubChem CID | 1084548 |
| Molecular Formula | C19H16ClN3O4 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-[(S)-(4-chlorophenyl)-(8-hydroxy-5-nitroquinolin-7-yl)methyl]propanamide |
| SMILES | CCC(=O)N[C@@H](c1ccc(Cl)cc1)c1cc([N+](=O)[O-])c2cccnc2c1O |
| InChI | InChI=1S/C19H16ClN3O4/c1-2-16(24)22-17(11-5-7-12(20)8-6-11)14-10-15(23(26)27)13-4-3-9-21-18(13)19(14)25/h3-10,17,25H,2H2,1H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | HEHXZAPDZQSUBE-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|