C25H21N3O5 — CID 67171815
N-[(8-hydroxy-5-nitroquinolin-7-yl)-(2-methylphenyl)methyl]-2-phenoxyacetamide (PubChem CID 67171815) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is N-[(8-hydroxy-5-nitroquinolin-7-yl)-(2-methylphenyl)methyl]-2-phenoxyacetamide.
| Compound Name | N-[(8-hydroxy-5-nitroquinolin-7-yl)-(2-methylphenyl)methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 67171815 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[(8-hydroxy-5-nitroquinolin-7-yl)-(2-methylphenyl)methyl]-2-phenoxyacetamide |
| SMILES | Cc1ccccc1C(NC(=O)COc1ccccc1)c1cc([N+](=O)[O-])c2cccnc2c1O |
| InChI | InChI=1S/C25H21N3O5/c1-16-8-5-6-11-18(16)23(27-22(29)15-33-17-9-3-2-4-10-17)20-14-21(28(31)32)19-12-7-13-26-24(19)25(20)30/h2-14,23,30H,15H2,1H3,(H,27,29) |
| InChIKey | YKXCIKPXTJZPIN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|