C22H17ClN2O4 — CID 4609641
N-[(5-chloro-8-hydroxyquinolin-7-yl)-(furan-2-yl)methyl]-2-phenoxyacetamide (PubChem CID 4609641) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is N-[(5-chloro-8-hydroxyquinolin-7-yl)-(furan-2-yl)methyl]-2-phenoxyacetamide.
| Compound Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-(furan-2-yl)methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 4609641 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-(furan-2-yl)methyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC(c1ccco1)c1cc(Cl)c2cccnc2c1O |
| InChI | InChI=1S/C22H17ClN2O4/c23-17-12-16(22(27)21-15(17)8-4-10-24-21)20(18-9-5-11-28-18)25-19(26)13-29-14-6-2-1-3-7-14/h1-12,20,27H,13H2,(H,25,26) |
| InChIKey | LRBZWXYIDAWDGK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|