C27H25ClN4O4 — CID 67170573
N-[3-[(5-chloro-8-hydroxyquinolin-7-yl)-[(2-phenoxyacetyl)amino]methyl]phenyl]-2-(methylamino)acetamide (PubChem CID 67170573) has the molecular formula C27H25ClN4O4 and a molecular weight of 504.97 g/mol. Its IUPAC name is N-[3-[(5-chloro-8-hydroxyquinolin-7-yl)-[(2-phenoxyacetyl)amino]methyl]phenyl]-2-(methylamino)acetamide.
| Compound Name | N-[3-[(5-chloro-8-hydroxyquinolin-7-yl)-[(2-phenoxyacetyl)amino]methyl]phenyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 67170573 |
| Molecular Formula | C27H25ClN4O4 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N-[3-[(5-chloro-8-hydroxyquinolin-7-yl)-[(2-phenoxyacetyl)amino]methyl]phenyl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)Nc1cccc(C(NC(=O)COc2ccccc2)c2cc(Cl)c3cccnc3c2O)c1 |
| InChI | InChI=1S/C27H25ClN4O4/c1-29-15-23(33)31-18-8-5-7-17(13-18)25(32-24(34)16-36-19-9-3-2-4-10-19)21-14-22(28)20-11-6-12-30-26(20)27(21)35/h2-14,25,29,35H,15-16H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | LWYJQSIZPXYPNG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|