C27H19ClN2O5 — CID 67171298
N-[(5-chloro-8-hydroxyquinolin-7-yl)-(4-oxochromen-3-yl)methyl]-2-phenoxyacetamide (PubChem CID 67171298) has the molecular formula C27H19ClN2O5 and a molecular weight of 486.91 g/mol. Its IUPAC name is N-[(5-chloro-8-hydroxyquinolin-7-yl)-(4-oxochromen-3-yl)methyl]-2-phenoxyacetamide.
| Compound Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-(4-oxochromen-3-yl)methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 67171298 |
| Molecular Formula | C27H19ClN2O5 |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-(4-oxochromen-3-yl)methyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC(c1cc(Cl)c2cccnc2c1O)c1coc2ccccc2c1=O |
| InChI | InChI=1S/C27H19ClN2O5/c28-21-13-19(27(33)25-17(21)10-6-12-29-25)24(30-23(31)15-34-16-7-2-1-3-8-16)20-14-35-22-11-5-4-9-18(22)26(20)32/h1-14,24,33H,15H2,(H,30,31) |
| InChIKey | OJJPYWPCGZAVLT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|