C23H17ClFN3O3 — CID 24961465
N-[(5-chloro-8-hydroxyquinolin-7-yl)-(3-fluorophenyl)methyl]-2-pyridin-3-yloxyacetamide (PubChem CID 24961465) has the molecular formula C23H17ClFN3O3 and a molecular weight of 437.86 g/mol. Its IUPAC name is N-[(5-chloro-8-hydroxyquinolin-7-yl)-(3-fluorophenyl)methyl]-2-pyridin-3-yloxyacetamide.
| Compound Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-(3-fluorophenyl)methyl]-2-pyridin-3-yloxyacetamide |
|---|---|
| PubChem CID | 24961465 |
| Molecular Formula | C23H17ClFN3O3 |
| Molecular Weight | 437.86 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-(3-fluorophenyl)methyl]-2-pyridin-3-yloxyacetamide |
| SMILES | O=C(COc1cccnc1)NC(c1cccc(F)c1)c1cc(Cl)c2cccnc2c1O |
| InChI | InChI=1S/C23H17ClFN3O3/c24-19-11-18(23(30)22-17(19)7-3-9-27-22)21(14-4-1-5-15(25)10-14)28-20(29)13-31-16-6-2-8-26-12-16/h1-12,21,30H,13H2,(H,28,29) |
| InChIKey | VVEUHZMRADBOCX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.86 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|