C54H43ClN4O7 — CID 159008930
N-[(5-chloro-8-hydroxyquinolin-7-yl)-phenylmethyl]-2-(4-phenoxyphenoxy)acetamide;N-[(8-hydroxyquinolin-7-yl)-phenylmethyl]-2-phenoxyacetamide (PubChem CID 159008930) has the molecular formula C54H43ClN4O7 and a molecular weight of 895.41 g/mol. Its IUPAC name is N-[(5-chloro-8-hydroxyquinolin-7-yl)-phenylmethyl]-2-(4-phenoxyphenoxy)acetamide;N-[(8-hydroxyquinolin-7-yl)-phenylmethyl]-2-phenoxyacetamide.
| Compound Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-phenylmethyl]-2-(4-phenoxyphenoxy)acetamide;N-[(8-hydroxyquinolin-7-yl)-phenylmethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 159008930 |
| Molecular Formula | C54H43ClN4O7 |
| Molecular Weight | 895.41 g/mol |
| Exact Mass | 894.28 |
| IUPAC Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-phenylmethyl]-2-(4-phenoxyphenoxy)acetamide;N-[(8-hydroxyquinolin-7-yl)-phenylmethyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccc(Oc2ccccc2)cc1)NC(c1ccccc1)c1cc(Cl)c2cccnc2c1O.O=C(COc1ccccc1)NC(c1ccccc1)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C30H23ClN2O4.C24H20N2O3/c31-26-18-25(30(35)29-24(26)12-7-17-32-29)28(20-8-3-1-4-9-20)33-27(34)19-36-21-13-15-23(16-14-21)37-22-10-5-2-6-11-22;27-21(16-29-19-11-5-2-6-12-19)26-22(17-8-3-1-4-9-17)20-14-13-18-10-7-15-25-23(18)24(20)28/h1-18,28,35H,19H2,(H,33,34);1-15,22,28H,16H2,(H,26,27) |
| InChIKey | JSGPKMZNGSFKHW-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 152.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.41 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|