C24H19ClN2O3 — CID 7030471
N-[(S)-(5-chloro-8-hydroxyquinolin-7-yl)-phenylmethyl]-3-methoxybenzamide (PubChem CID 7030471) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is N-[(S)-(5-chloro-8-hydroxyquinolin-7-yl)-phenylmethyl]-3-methoxybenzamide.
| Compound Name | N-[(S)-(5-chloro-8-hydroxyquinolin-7-yl)-phenylmethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 7030471 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[(S)-(5-chloro-8-hydroxyquinolin-7-yl)-phenylmethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N[C@@H](c2ccccc2)c2cc(Cl)c3cccnc3c2O)c1 |
| InChI | InChI=1S/C24H19ClN2O3/c1-30-17-10-5-9-16(13-17)24(29)27-21(15-7-3-2-4-8-15)19-14-20(25)18-11-6-12-26-22(18)23(19)28/h2-14,21,28H,1H3,(H,27,29)/t21-/m0/s1 |
| InChIKey | JDDZIBLXGVHHBX-NRFANRHFSA-N |
| XLogP | 5.12 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|