C18H16N3O4S- — CID 7120585
7-[(S)-(2-methylpropanoylamino)-thiophen-2-ylmethyl]-5-nitroquinolin-8-olate (PubChem CID 7120585) has the molecular formula C18H16N3O4S- and a molecular weight of 370.41 g/mol. Its IUPAC name is 7-[(S)-(2-methylpropanoylamino)-thiophen-2-ylmethyl]-5-nitroquinolin-8-olate.
| Compound Name | 7-[(S)-(2-methylpropanoylamino)-thiophen-2-ylmethyl]-5-nitroquinolin-8-olate |
|---|---|
| PubChem CID | 7120585 |
| Molecular Formula | C18H16N3O4S- |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 7-[(S)-(2-methylpropanoylamino)-thiophen-2-ylmethyl]-5-nitroquinolin-8-olate |
| SMILES | CC(C)C(=O)N[C@H](c1cccs1)c1cc([N+](=O)[O-])c2cccnc2c1[O-] |
| InChI | InChI=1S/C18H17N3O4S/c1-10(2)18(23)20-15(14-6-4-8-26-14)12-9-13(21(24)25)11-5-3-7-19-16(11)17(12)22/h3-10,15,22H,1-2H3,(H,20,23)/p-1/t15-/m0/s1 |
| InChIKey | UGVXTILPQFDWHE-HNNXBMFYSA-M |
| XLogP | 3.14 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|