C18H18N2O3S — CID 176719635
N-[(5,8-dihydroxyquinolin-7-yl)-thiophen-2-ylmethyl]-2-methylpropanamide (PubChem CID 176719635) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[(5,8-dihydroxyquinolin-7-yl)-thiophen-2-ylmethyl]-2-methylpropanamide.
| Compound Name | N-[(5,8-dihydroxyquinolin-7-yl)-thiophen-2-ylmethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 176719635 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[(5,8-dihydroxyquinolin-7-yl)-thiophen-2-ylmethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(c1cccs1)c1cc(O)c2cccnc2c1O |
| InChI | InChI=1S/C18H18N2O3S/c1-10(2)18(23)20-15(14-6-4-8-24-14)12-9-13(21)11-5-3-7-19-16(11)17(12)22/h3-10,15,21-22H,1-2H3,(H,20,23) |
| InChIKey | UBMLMYRMGBKISM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|