C20H21N3O3 — CID 176719634
N-[(5,8-dihydroxyquinolin-7-yl)-[4-(dimethylamino)phenyl]methyl]acetamide (PubChem CID 176719634) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[(5,8-dihydroxyquinolin-7-yl)-[4-(dimethylamino)phenyl]methyl]acetamide.
| Compound Name | N-[(5,8-dihydroxyquinolin-7-yl)-[4-(dimethylamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 176719634 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[(5,8-dihydroxyquinolin-7-yl)-[4-(dimethylamino)phenyl]methyl]acetamide |
| SMILES | CC(=O)NC(c1ccc(N(C)C)cc1)c1cc(O)c2cccnc2c1O |
| InChI | InChI=1S/C20H21N3O3/c1-12(24)22-18(13-6-8-14(9-7-13)23(2)3)16-11-17(25)15-5-4-10-21-19(15)20(16)26/h4-11,18,25-26H,1-3H3,(H,22,24) |
| InChIKey | SFSFEJUDDRNDQN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|