C27H20N2O2 — CID 2173643
N-[(S)-(8-hydroxyquinolin-7-yl)-naphthalen-2-ylmethyl]benzamide (PubChem CID 2173643) has the molecular formula C27H20N2O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[(S)-(8-hydroxyquinolin-7-yl)-naphthalen-2-ylmethyl]benzamide.
| Compound Name | N-[(S)-(8-hydroxyquinolin-7-yl)-naphthalen-2-ylmethyl]benzamide |
|---|---|
| PubChem CID | 2173643 |
| Molecular Formula | C27H20N2O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[(S)-(8-hydroxyquinolin-7-yl)-naphthalen-2-ylmethyl]benzamide |
| SMILES | O=C(N[C@@H](c1ccc2ccccc2c1)c1ccc2cccnc2c1O)c1ccccc1 |
| InChI | InChI=1S/C27H20N2O2/c30-26-23(15-14-19-11-6-16-28-25(19)26)24(29-27(31)20-8-2-1-3-9-20)22-13-12-18-7-4-5-10-21(18)17-22/h1-17,24,30H,(H,29,31)/t24-/m0/s1 |
| InChIKey | JOLVTJDJGLWIHV-DEOSSOPVSA-N |
| XLogP | 5.61 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|