C26H24N2O2 — CID 1084506
N-[(S)-(8-hydroxyquinolin-7-yl)-(4-methylphenyl)methyl]-3-phenylpropanamide (PubChem CID 1084506) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[(S)-(8-hydroxyquinolin-7-yl)-(4-methylphenyl)methyl]-3-phenylpropanamide.
| Compound Name | N-[(S)-(8-hydroxyquinolin-7-yl)-(4-methylphenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 1084506 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-[(S)-(8-hydroxyquinolin-7-yl)-(4-methylphenyl)methyl]-3-phenylpropanamide |
| SMILES | Cc1ccc([C@H](NC(=O)CCc2ccccc2)c2ccc3cccnc3c2O)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-18-9-12-21(13-10-18)24(28-23(29)16-11-19-6-3-2-4-7-19)22-15-14-20-8-5-17-27-25(20)26(22)30/h2-10,12-15,17,24,30H,11,16H2,1H3,(H,28,29)/t24-/m0/s1 |
| InChIKey | NTOMTWHLAMHYRJ-DEOSSOPVSA-N |
| XLogP | 5.09 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|