C23H23NO4 — CID 1084527
N-[(S)-1,3-benzodioxol-5-yl-(2-hydroxynaphthalen-1-yl)methyl]-3-methylbutanamide (PubChem CID 1084527) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[(S)-1,3-benzodioxol-5-yl-(2-hydroxynaphthalen-1-yl)methyl]-3-methylbutanamide.
| Compound Name | N-[(S)-1,3-benzodioxol-5-yl-(2-hydroxynaphthalen-1-yl)methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 1084527 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[(S)-1,3-benzodioxol-5-yl-(2-hydroxynaphthalen-1-yl)methyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)N[C@@H](c1ccc2c(c1)OCO2)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C23H23NO4/c1-14(2)11-21(26)24-23(16-8-10-19-20(12-16)28-13-27-19)22-17-6-4-3-5-15(17)7-9-18(22)25/h3-10,12,14,23,25H,11,13H2,1-2H3,(H,24,26)/t23-/m0/s1 |
| InChIKey | ZKBYNAHZSXADQH-QHCPKHFHSA-N |
| XLogP | 4.53 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|