C33H30N2O3 — CID 93119964
(3S)-N-benzhydryl-3-(1,3-benzodioxol-5-yl)-3-(1-ethylindol-3-yl)propanamide (PubChem CID 93119964) has the molecular formula C33H30N2O3 and a molecular weight of 502.61 g/mol. Its IUPAC name is (3S)-N-benzhydryl-3-(1,3-benzodioxol-5-yl)-3-(1-ethylindol-3-yl)propanamide.
| Compound Name | (3S)-N-benzhydryl-3-(1,3-benzodioxol-5-yl)-3-(1-ethylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 93119964 |
| Molecular Formula | C33H30N2O3 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | (3S)-N-benzhydryl-3-(1,3-benzodioxol-5-yl)-3-(1-ethylindol-3-yl)propanamide |
| SMILES | CCn1cc([C@@H](CC(=O)NC(c2ccccc2)c2ccccc2)c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C33H30N2O3/c1-2-35-21-28(26-15-9-10-16-29(26)35)27(25-17-18-30-31(19-25)38-22-37-30)20-32(36)34-33(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-19,21,27,33H,2,20,22H2,1H3,(H,34,36)/t27-/m0/s1 |
| InChIKey | XDVSFVUSGIHONO-MHZLTWQESA-N |
| XLogP | 6.82 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |