C28H28N2O3 — CID 42801311
3-(1,3-benzodioxol-5-yl)-3-(1-ethylindol-3-yl)-N-(2-phenylethyl)propanamide (PubChem CID 42801311) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-(1-ethylindol-3-yl)-N-(2-phenylethyl)propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-3-(1-ethylindol-3-yl)-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 42801311 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-3-(1-ethylindol-3-yl)-N-(2-phenylethyl)propanamide |
| SMILES | CCn1cc(C(CC(=O)NCCc2ccccc2)c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C28H28N2O3/c1-2-30-18-24(22-10-6-7-11-25(22)30)23(21-12-13-26-27(16-21)33-19-32-26)17-28(31)29-15-14-20-8-4-3-5-9-20/h3-13,16,18,23H,2,14-15,17,19H2,1H3,(H,29,31) |
| InChIKey | ODSVJFLODGCCSS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |