C22H22ClN5O2 — CID 164865586
N-[(5-chloro-8-hydroxyquinolin-7-yl)-pyridin-3-ylmethyl]-2-(2,5-diazabicyclo[2.2.1]heptan-2-yl)acetamide (PubChem CID 164865586) has the molecular formula C22H22ClN5O2 and a molecular weight of 423.90 g/mol. Its IUPAC name is N-[(5-chloro-8-hydroxyquinolin-7-yl)-pyridin-3-ylmethyl]-2-(2,5-diazabicyclo[2.2.1]heptan-2-yl)acetamide.
| Compound Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-pyridin-3-ylmethyl]-2-(2,5-diazabicyclo[2.2.1]heptan-2-yl)acetamide |
|---|---|
| PubChem CID | 164865586 |
| Molecular Formula | C22H22ClN5O2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-pyridin-3-ylmethyl]-2-(2,5-diazabicyclo[2.2.1]heptan-2-yl)acetamide |
| SMILES | O=C(CN1CC2CC1CN2)NC(c1cccnc1)c1cc(Cl)c2cccnc2c1O |
| InChI | InChI=1S/C22H22ClN5O2/c23-18-8-17(22(30)21-16(18)4-2-6-25-21)20(13-3-1-5-24-9-13)27-19(29)12-28-11-14-7-15(28)10-26-14/h1-6,8-9,14-15,20,26,30H,7,10-12H2,(H,27,29) |
| InChIKey | COEQRKTXLLSIRB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|