C21H28N4+2 — CID 7106173
3-[(S)-(4-ethylpiperazine-1,4-diium-1-yl)-pyridin-2-ylmethyl]-2-methyl-1H-indole (PubChem CID 7106173) has the molecular formula C21H28N4+2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 3-[(S)-(4-ethylpiperazine-1,4-diium-1-yl)-pyridin-2-ylmethyl]-2-methyl-1H-indole.
| Compound Name | 3-[(S)-(4-ethylpiperazine-1,4-diium-1-yl)-pyridin-2-ylmethyl]-2-methyl-1H-indole |
|---|---|
| PubChem CID | 7106173 |
| Molecular Formula | C21H28N4+2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 3-[(S)-(4-ethylpiperazine-1,4-diium-1-yl)-pyridin-2-ylmethyl]-2-methyl-1H-indole |
| SMILES | CC[NH+]1CC[NH+]([C@H](c2ccccn2)c2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C21H26N4/c1-3-24-12-14-25(15-13-24)21(19-10-6-7-11-22-19)20-16(2)23-18-9-5-4-8-17(18)20/h4-11,21,23H,3,12-15H2,1-2H3/p+2/t21-/m1/s1 |
| InChIKey | HTYVABBUQLNZKB-OAQYLSRUSA-P |
| XLogP | 0.76 |
| TPSA | 37.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|