C25H25FN4 — CID 5182882
3-[[4-(4-fluorophenyl)piperazin-1-yl]-pyridin-2-ylmethyl]-2-methyl-1H-indole (PubChem CID 5182882) has the molecular formula C25H25FN4 and a molecular weight of 400.50 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)piperazin-1-yl]-pyridin-2-ylmethyl]-2-methyl-1H-indole.
| Compound Name | 3-[[4-(4-fluorophenyl)piperazin-1-yl]-pyridin-2-ylmethyl]-2-methyl-1H-indole |
|---|---|
| PubChem CID | 5182882 |
| Molecular Formula | C25H25FN4 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)piperazin-1-yl]-pyridin-2-ylmethyl]-2-methyl-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1C(c1ccccn1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H25FN4/c1-18-24(21-6-2-3-7-22(21)28-18)25(23-8-4-5-13-27-23)30-16-14-29(15-17-30)20-11-9-19(26)10-12-20/h2-13,25,28H,14-17H2,1H3 |
| InChIKey | YTYZIQLASLKRKT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|