C25H27N4+ — CID 7113557
2-methyl-3-[(S)-(4-phenylpiperazin-1-ium-1-yl)-pyridin-2-ylmethyl]-1H-indole (PubChem CID 7113557) has the molecular formula C25H27N4+ and a molecular weight of 383.52 g/mol. Its IUPAC name is 2-methyl-3-[(S)-(4-phenylpiperazin-1-ium-1-yl)-pyridin-2-ylmethyl]-1H-indole.
| Compound Name | 2-methyl-3-[(S)-(4-phenylpiperazin-1-ium-1-yl)-pyridin-2-ylmethyl]-1H-indole |
|---|---|
| PubChem CID | 7113557 |
| Molecular Formula | C25H27N4+ |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2-methyl-3-[(S)-(4-phenylpiperazin-1-ium-1-yl)-pyridin-2-ylmethyl]-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H](c1ccccn1)[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H26N4/c1-19-24(21-11-5-6-12-22(21)27-19)25(23-13-7-8-14-26-23)29-17-15-28(16-18-29)20-9-3-2-4-10-20/h2-14,25,27H,15-18H2,1H3/p+1/t25-/m1/s1 |
| InChIKey | DUHNMPWAWHWCHD-RUZDIDTESA-O |
| XLogP | 3.37 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|