C20H26N4+2 — CID 7024265
2-methyl-3-[(R)-(4-methylpiperazine-1,4-diium-1-yl)-pyridin-4-ylmethyl]-1H-indole (PubChem CID 7024265) has the molecular formula C20H26N4+2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-methyl-3-[(R)-(4-methylpiperazine-1,4-diium-1-yl)-pyridin-4-ylmethyl]-1H-indole.
| Compound Name | 2-methyl-3-[(R)-(4-methylpiperazine-1,4-diium-1-yl)-pyridin-4-ylmethyl]-1H-indole |
|---|---|
| PubChem CID | 7024265 |
| Molecular Formula | C20H26N4+2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-methyl-3-[(R)-(4-methylpiperazine-1,4-diium-1-yl)-pyridin-4-ylmethyl]-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H](c1ccncc1)[NH+]1CC[NH+](C)CC1 |
| InChI | InChI=1S/C20H24N4/c1-15-19(17-5-3-4-6-18(17)22-15)20(16-7-9-21-10-8-16)24-13-11-23(2)12-14-24/h3-10,20,22H,11-14H2,1-2H3/p+2/t20-/m1/s1 |
| InChIKey | BLYAYCLKDQAOOO-HXUWFJFHSA-P |
| XLogP | 0.37 |
| TPSA | 37.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|