C21H26N3+ — CID 7150241
2-methyl-3-[(R)-(4-methylpiperidin-1-ium-1-yl)-pyridin-4-ylmethyl]-1H-indole (PubChem CID 7150241) has the molecular formula C21H26N3+ and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-methyl-3-[(R)-(4-methylpiperidin-1-ium-1-yl)-pyridin-4-ylmethyl]-1H-indole.
| Compound Name | 2-methyl-3-[(R)-(4-methylpiperidin-1-ium-1-yl)-pyridin-4-ylmethyl]-1H-indole |
|---|---|
| PubChem CID | 7150241 |
| Molecular Formula | C21H26N3+ |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-methyl-3-[(R)-(4-methylpiperidin-1-ium-1-yl)-pyridin-4-ylmethyl]-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H](c1ccncc1)[NH+]1CCC(C)CC1 |
| InChI | InChI=1S/C21H25N3/c1-15-9-13-24(14-10-15)21(17-7-11-22-12-8-17)20-16(2)23-19-6-4-3-5-18(19)20/h3-8,11-12,15,21,23H,9-10,13-14H2,1-2H3/p+1/t21-/m1/s1 |
| InChIKey | CABFEBBOJPREEP-OAQYLSRUSA-O |
| XLogP | 3.28 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|