C23H29N2+ — CID 7165575
2-methyl-3-[(R)-(4-methylphenyl)-(4-methylpiperidin-1-ium-1-yl)methyl]-1H-indole (PubChem CID 7165575) has the molecular formula C23H29N2+ and a molecular weight of 333.50 g/mol. Its IUPAC name is 2-methyl-3-[(R)-(4-methylphenyl)-(4-methylpiperidin-1-ium-1-yl)methyl]-1H-indole.
| Compound Name | 2-methyl-3-[(R)-(4-methylphenyl)-(4-methylpiperidin-1-ium-1-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 7165575 |
| Molecular Formula | C23H29N2+ |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 2-methyl-3-[(R)-(4-methylphenyl)-(4-methylpiperidin-1-ium-1-yl)methyl]-1H-indole |
| SMILES | Cc1ccc([C@H](c2c(C)[nH]c3ccccc23)[NH+]2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C23H28N2/c1-16-8-10-19(11-9-16)23(25-14-12-17(2)13-15-25)22-18(3)24-21-7-5-4-6-20(21)22/h4-11,17,23-24H,12-15H2,1-3H3/p+1/t23-/m1/s1 |
| InChIKey | FWHWPZDAJBKAOF-HSZRJFAPSA-O |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|