C19H23N3O+2 — CID 4065680
4-[(2-methyl-1H-indol-3-yl)-pyridin-1-ium-4-ylmethyl]morpholin-4-ium (PubChem CID 4065680) has the molecular formula C19H23N3O+2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-[(2-methyl-1H-indol-3-yl)-pyridin-1-ium-4-ylmethyl]morpholin-4-ium.
| Compound Name | 4-[(2-methyl-1H-indol-3-yl)-pyridin-1-ium-4-ylmethyl]morpholin-4-ium |
|---|---|
| PubChem CID | 4065680 |
| Molecular Formula | C19H23N3O+2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 4-[(2-methyl-1H-indol-3-yl)-pyridin-1-ium-4-ylmethyl]morpholin-4-ium |
| SMILES | Cc1[nH]c2ccccc2c1C(c1cc[nH+]cc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H21N3O/c1-14-18(16-4-2-3-5-17(16)21-14)19(15-6-8-20-9-7-15)22-10-12-23-13-11-22/h2-9,19,21H,10-13H2,1H3/p+2 |
| InChIKey | OTZHIQOGDANTHW-UHFFFAOYSA-P |
| XLogP | 1.29 |
| TPSA | 43.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|