C24H24FN3S — CID 4163029
3-[[4-(4-fluorophenyl)piperazin-1-yl]-thiophen-2-ylmethyl]-2-methyl-1H-indole (PubChem CID 4163029) has the molecular formula C24H24FN3S and a molecular weight of 405.54 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)piperazin-1-yl]-thiophen-2-ylmethyl]-2-methyl-1H-indole.
| Compound Name | 3-[[4-(4-fluorophenyl)piperazin-1-yl]-thiophen-2-ylmethyl]-2-methyl-1H-indole |
|---|---|
| PubChem CID | 4163029 |
| Molecular Formula | C24H24FN3S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)piperazin-1-yl]-thiophen-2-ylmethyl]-2-methyl-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1C(c1cccs1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H24FN3S/c1-17-23(20-5-2-3-6-21(20)26-17)24(22-7-4-16-29-22)28-14-12-27(13-15-28)19-10-8-18(25)9-11-19/h2-11,16,24,26H,12-15H2,1H3 |
| InChIKey | UXBFWPHVZCTVEJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|