C23H29N3 — CID 110453369
3-[(4-ethylphenyl)-(4-methylpiperazin-1-yl)methyl]-2-methyl-1H-indole (PubChem CID 110453369) has the molecular formula C23H29N3 and a molecular weight of 347.51 g/mol. Its IUPAC name is 3-[(4-ethylphenyl)-(4-methylpiperazin-1-yl)methyl]-2-methyl-1H-indole.
| Compound Name | 3-[(4-ethylphenyl)-(4-methylpiperazin-1-yl)methyl]-2-methyl-1H-indole |
|---|---|
| PubChem CID | 110453369 |
| Molecular Formula | C23H29N3 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 3-[(4-ethylphenyl)-(4-methylpiperazin-1-yl)methyl]-2-methyl-1H-indole |
| SMILES | CCc1ccc(C(c2c(C)[nH]c3ccccc23)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C23H29N3/c1-4-18-9-11-19(12-10-18)23(26-15-13-25(3)14-16-26)22-17(2)24-21-8-6-5-7-20(21)22/h5-12,23-24H,4,13-16H2,1-3H3 |
| InChIKey | HRPVCLSZOVUSEQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|