C12H13NO3 — CID 170818071
1-quinolin-7-ylpropane-1,2,3-triol (PubChem CID 170818071) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-quinolin-7-ylpropane-1,2,3-triol.
| Compound Name | 1-quinolin-7-ylpropane-1,2,3-triol |
|---|---|
| PubChem CID | 170818071 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-quinolin-7-ylpropane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C12H13NO3/c14-7-11(15)12(16)9-4-3-8-2-1-5-13-10(8)6-9/h1-6,11-12,14-16H,7H2 |
| InChIKey | BCMOBBGYPAZDFG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |